About [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate
[3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate (PubChem CID 110274725) has the molecular formula C19H11BrClF3O4
and a molecular weight of 475.64 g/mol. Its IUPAC name is [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate |
| PubChem CID | 110274725 |
| Molecular Formula | C19H11BrClF3O4 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 473.95 |
| IUPAC Name | [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate |
| SMILES | CC(Cl)C(=O)Oc1ccc2c(=O)c(-c3ccc(Br)cc3)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C19H11BrClF3O4/c1-9(21)18(26)27-12-6-7-13-14(8-12)28-17(19(22,23)24)15(16(13)25)10-2-4-11(20)5-3-10/h2-9H,1H3 |
| InChIKey | DAMQERUQLGXCCR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate?
The IUPAC name of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate (CID 110274725) is [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate.
What is the SMILES notation for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate?
The canonical SMILES for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate is CC(Cl)C(=O)Oc1ccc2c(=O)c(-c3ccc(Br)cc3)c(C(F)(F)F)oc2c1.
What is the InChIKey of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate?
The InChIKey is DAMQERUQLGXCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11BrClF3O4/c1-9(21)18(26)27-12-6-7-13-14(8-12)28-17(19(22,23)24)15(16(13)25)10-2-4-11(20)5-3-10/h2-9H,1H3.
What are the key properties of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate?
[3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate has a molecular weight of 475.64 g/mol, XLogP of 5.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-chloropropanoate is sourced from PubChem (CID 110274725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).