About [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate
[3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate (PubChem CID 95398549) has the molecular formula C23H11BrClF3O4
and a molecular weight of 523.69 g/mol. Its IUPAC name is [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate |
| PubChem CID | 95398549 |
| Molecular Formula | C23H11BrClF3O4 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate |
| SMILES | O=C(Oc1ccc2c(=O)c(-c3ccc(Br)cc3)c(C(F)(F)F)oc2c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H11BrClF3O4/c24-14-6-4-12(5-7-14)19-20(29)17-9-8-16(11-18(17)32-21(19)23(26,27)28)31-22(30)13-2-1-3-15(25)10-13/h1-11H |
| InChIKey | CQLIOAVVXBKVEU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate?
The IUPAC name of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate (CID 95398549) is [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate.
What is the SMILES notation for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate?
The canonical SMILES for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate is O=C(Oc1ccc2c(=O)c(-c3ccc(Br)cc3)c(C(F)(F)F)oc2c1)c1cccc(Cl)c1.
What is the InChIKey of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate?
The InChIKey is CQLIOAVVXBKVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H11BrClF3O4/c24-14-6-4-12(5-7-14)19-20(29)17-9-8-16(11-18(17)32-21(19)23(26,27)28)31-22(30)13-2-1-3-15(25)10-13/h1-11H.
What are the key properties of [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate?
[3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate has a molecular weight of 523.69 g/mol, XLogP of 7.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-chlorobenzoate is sourced from PubChem (CID 95398549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).