C23H14BrF3O3 — CID 3572340
7-[(4-bromophenyl)methoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one (PubChem CID 3572340) has the molecular formula C23H14BrF3O3 and a molecular weight of 475.26 g/mol. Its IUPAC name is 7-[(4-bromophenyl)methoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-[(4-bromophenyl)methoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 3572340 |
| Molecular Formula | C23H14BrF3O3 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 7-[(4-bromophenyl)methoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
| SMILES | O=c1c(-c2ccccc2)c(C(F)(F)F)oc2cc(OCc3ccc(Br)cc3)ccc12 |
| InChI | InChI=1S/C23H14BrF3O3/c24-16-8-6-14(7-9-16)13-29-17-10-11-18-19(12-17)30-22(23(25,26)27)20(21(18)28)15-4-2-1-3-5-15/h1-12H,13H2 |
| InChIKey | FDJQHRIYOVGDSC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |