C25H16BrF3O4 — CID 95398780
3-(2-bromophenoxy)-7-[(4-ethenylphenyl)methoxy]-2-(trifluoromethyl)chromen-4-one (PubChem CID 95398780) has the molecular formula C25H16BrF3O4 and a molecular weight of 517.30 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-7-[(4-ethenylphenyl)methoxy]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-bromophenoxy)-7-[(4-ethenylphenyl)methoxy]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 95398780 |
| Molecular Formula | C25H16BrF3O4 |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 3-(2-bromophenoxy)-7-[(4-ethenylphenyl)methoxy]-2-(trifluoromethyl)chromen-4-one |
| SMILES | C=Cc1ccc(COc2ccc3c(=O)c(Oc4ccccc4Br)c(C(F)(F)F)oc3c2)cc1 |
| InChI | InChI=1S/C25H16BrF3O4/c1-2-15-7-9-16(10-8-15)14-31-17-11-12-18-21(13-17)33-24(25(27,28)29)23(22(18)30)32-20-6-4-3-5-19(20)26/h2-13H,1,14H2 |
| InChIKey | JSGHPWGZJHLICY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |