C18H13F3O5 — CID 5449307
3-(2-ethoxyphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 5449307) has the molecular formula C18H13F3O5 and a molecular weight of 366.29 g/mol. Its IUPAC name is 3-(2-ethoxyphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-ethoxyphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5449307 |
| Molecular Formula | C18H13F3O5 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-(2-ethoxyphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | CCOc1ccccc1Oc1c(C(F)(F)F)oc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C18H13F3O5/c1-2-24-12-5-3-4-6-13(12)25-16-15(23)11-8-7-10(22)9-14(11)26-17(16)18(19,20)21/h3-9,22H,2H2,1H3 |
| InChIKey | HXUMLKHADLLMBY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |