C24H14F4O6 — CID 2002161
[3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-fluorobenzoate (PubChem CID 2002161) has the molecular formula C24H14F4O6 and a molecular weight of 474.36 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-fluorobenzoate.
| Compound Name | [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2002161 |
| Molecular Formula | C24H14F4O6 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-fluorobenzoate |
| SMILES | COc1ccccc1Oc1c(C(F)(F)F)oc2cc(OC(=O)c3ccc(F)cc3)ccc2c1=O |
| InChI | InChI=1S/C24H14F4O6/c1-31-17-4-2-3-5-18(17)33-21-20(29)16-11-10-15(12-19(16)34-22(21)24(26,27)28)32-23(30)13-6-8-14(25)9-7-13/h2-12H,1H3 |
| InChIKey | MYVZGTDSTFXAQX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|