C28H21F3O9 — CID 95397751
[3-(4-ethoxycarbonylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate (PubChem CID 95397751) has the molecular formula C28H21F3O9 and a molecular weight of 558.46 g/mol. Its IUPAC name is [3-(4-ethoxycarbonylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate.
| Compound Name | [3-(4-ethoxycarbonylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 95397751 |
| Molecular Formula | C28H21F3O9 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | [3-(4-ethoxycarbonylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)c4ccc(OC)c(OC)c4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C28H21F3O9/c1-4-37-26(33)15-5-8-17(9-6-15)38-24-23(32)19-11-10-18(14-21(19)40-25(24)28(29,30)31)39-27(34)16-7-12-20(35-2)22(13-16)36-3/h5-14H,4H2,1-3H3 |
| InChIKey | DKQPHPLLLQLWHS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 110.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|