C32H22F3NO7 — CID 4631054
ethyl 4-[7-(diphenylcarbamoyloxy)-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 4631054) has the molecular formula C32H22F3NO7 and a molecular weight of 589.52 g/mol. Its IUPAC name is ethyl 4-[7-(diphenylcarbamoyloxy)-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | ethyl 4-[7-(diphenylcarbamoyloxy)-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 4631054 |
| Molecular Formula | C32H22F3NO7 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | ethyl 4-[7-(diphenylcarbamoyloxy)-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)N(c4ccccc4)c4ccccc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C32H22F3NO7/c1-2-40-30(38)20-13-15-23(16-14-20)41-28-27(37)25-18-17-24(19-26(25)43-29(28)32(33,34)35)42-31(39)36(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-19H,2H2,1H3 |
| InChIKey | LZKAYIONPYQIIH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |