C26H18ClF3O6 — CID 95398590
ethyl 4-[7-[(2-chlorophenyl)methoxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 95398590) has the molecular formula C26H18ClF3O6 and a molecular weight of 518.87 g/mol. Its IUPAC name is ethyl 4-[7-[(2-chlorophenyl)methoxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | ethyl 4-[7-[(2-chlorophenyl)methoxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 95398590 |
| Molecular Formula | C26H18ClF3O6 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | ethyl 4-[7-[(2-chlorophenyl)methoxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3cc(OCc4ccccc4Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H18ClF3O6/c1-2-33-25(32)15-7-9-17(10-8-15)35-23-22(31)19-12-11-18(13-21(19)36-24(23)26(28,29)30)34-14-16-5-3-4-6-20(16)27/h3-13H,2,14H2,1H3 |
| InChIKey | IMJMYTWEABVOJX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |