C27H24O6 — CID 2000239
ethyl 4-[2-methyl-7-[(4-methylphenyl)methoxy]-4-oxochromen-3-yl]oxybenzoate (PubChem CID 2000239) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is ethyl 4-[2-methyl-7-[(4-methylphenyl)methoxy]-4-oxochromen-3-yl]oxybenzoate.
| Compound Name | ethyl 4-[2-methyl-7-[(4-methylphenyl)methoxy]-4-oxochromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 2000239 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | ethyl 4-[2-methyl-7-[(4-methylphenyl)methoxy]-4-oxochromen-3-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2c(C)oc3cc(OCc4ccc(C)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C27H24O6/c1-4-30-27(29)20-9-11-21(12-10-20)33-26-18(3)32-24-15-22(13-14-23(24)25(26)28)31-16-19-7-5-17(2)6-8-19/h5-15H,4,16H2,1-3H3 |
| InChIKey | WPARQBCOVJGTSR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |