C29H21ClO8 — CID 95398357
[2-methyl-4-oxo-3-(4-propoxycarbonylphenoxy)chromen-7-yl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 95398357) has the molecular formula C29H21ClO8 and a molecular weight of 532.93 g/mol. Its IUPAC name is [2-methyl-4-oxo-3-(4-propoxycarbonylphenoxy)chromen-7-yl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-methyl-4-oxo-3-(4-propoxycarbonylphenoxy)chromen-7-yl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398357 |
| Molecular Formula | C29H21ClO8 |
| Molecular Weight | 532.93 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | [2-methyl-4-oxo-3-(4-propoxycarbonylphenoxy)chromen-7-yl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | CCCOC(=O)c1ccc(Oc2c(C)oc3cc(OC(=O)c4cc5cc(Cl)ccc5o4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C29H21ClO8/c1-3-12-34-28(32)17-4-7-20(8-5-17)36-27-16(2)35-24-15-21(9-10-22(24)26(27)31)37-29(33)25-14-18-13-19(30)6-11-23(18)38-25/h4-11,13-15H,3,12H2,1-2H3 |
| InChIKey | XZHRCZWQMPKTLK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 105.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.93 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|