C19H16ClNO4 — CID 19240947
propyl 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]benzoate (PubChem CID 19240947) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is propyl 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]benzoate.
| Compound Name | propyl 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19240947 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | propyl 4-[(5-chloro-1-benzofuran-2-carbonyl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2cc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C19H16ClNO4/c1-2-9-24-19(23)12-3-6-15(7-4-12)21-18(22)17-11-13-10-14(20)5-8-16(13)25-17/h3-8,10-11H,2,9H2,1H3,(H,21,22) |
| InChIKey | YWSJYJZYOQGZNM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |