C17H15ClN2O4S — CID 9328773
5-chloro-N-[4-(dimethylsulfamoyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 9328773) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is 5-chloro-N-[4-(dimethylsulfamoyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(dimethylsulfamoyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9328773 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 5-chloro-N-[4-(dimethylsulfamoyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)c2cc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-20(2)25(22,23)14-6-4-13(5-7-14)19-17(21)16-10-11-9-12(18)3-8-15(11)24-16/h3-10H,1-2H3,(H,19,21) |
| InChIKey | QXXFTIDDWFRUGE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |