C17H14ClNO4S — CID 26812074
5-chloro-N-(2-methyl-5-methylsulfonylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 26812074) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-chloro-N-(2-methyl-5-methylsulfonylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(2-methyl-5-methylsulfonylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26812074 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 5-chloro-N-(2-methyl-5-methylsulfonylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H14ClNO4S/c1-10-3-5-13(24(2,21)22)9-14(10)19-17(20)16-8-11-7-12(18)4-6-15(11)23-16/h3-9H,1-2H3,(H,19,20) |
| InChIKey | FSLAUVVKORYSSP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |