C19H18ClNO3 — CID 19240940
N-(2-butoxyphenyl)-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 19240940) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-(2-butoxyphenyl)-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-butoxyphenyl)-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19240940 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(2-butoxyphenyl)-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | CCCCOc1ccccc1NC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H18ClNO3/c1-2-3-10-23-17-7-5-4-6-15(17)21-19(22)18-12-13-11-14(20)8-9-16(13)24-18/h4-9,11-12H,2-3,10H2,1H3,(H,21,22) |
| InChIKey | XAHLIOBNZNKZQP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|