C22H21ClFNO3 — CID 71051932
5-[(2-butoxy-5-chlorophenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide (PubChem CID 71051932) has the molecular formula C22H21ClFNO3 and a molecular weight of 401.87 g/mol. Its IUPAC name is 5-[(2-butoxy-5-chlorophenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-butoxy-5-chlorophenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71051932 |
| Molecular Formula | C22H21ClFNO3 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[(2-butoxy-5-chlorophenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
| SMILES | CCCCOc1ccc(Cl)cc1Cc1ccc(C(=O)Nc2ccccc2F)o1 |
| InChI | InChI=1S/C22H21ClFNO3/c1-2-3-12-27-20-10-8-16(23)13-15(20)14-17-9-11-21(28-17)22(26)25-19-7-5-4-6-18(19)24/h4-11,13H,2-3,12,14H2,1H3,(H,25,26) |
| InChIKey | YQCHXWFYXODARU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|