C20H14ClF2NO4 — CID 59845829
[4-chloro-2-[[5-[(2,6-difluorophenyl)carbamoyl]furan-2-yl]methyl]phenyl] acetate (PubChem CID 59845829) has the molecular formula C20H14ClF2NO4 and a molecular weight of 405.78 g/mol. Its IUPAC name is [4-chloro-2-[[5-[(2,6-difluorophenyl)carbamoyl]furan-2-yl]methyl]phenyl] acetate.
| Compound Name | [4-chloro-2-[[5-[(2,6-difluorophenyl)carbamoyl]furan-2-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 59845829 |
| Molecular Formula | C20H14ClF2NO4 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [4-chloro-2-[[5-[(2,6-difluorophenyl)carbamoyl]furan-2-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)cc1Cc1ccc(C(=O)Nc2c(F)cccc2F)o1 |
| InChI | InChI=1S/C20H14ClF2NO4/c1-11(25)27-17-7-5-13(21)9-12(17)10-14-6-8-18(28-14)20(26)24-19-15(22)3-2-4-16(19)23/h2-9H,10H2,1H3,(H,24,26) |
| InChIKey | KGDGXWWJDQWKQP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|