C19H13ClFNaO4 — CID 23667794
sodium 5-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate (PubChem CID 23667794) has the molecular formula C19H13ClFNaO4 and a molecular weight of 382.75 g/mol. Its IUPAC name is sodium 5-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate.
| Compound Name | sodium 5-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 23667794 |
| Molecular Formula | C19H13ClFNaO4 |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | sodium 5-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(Cc2cc(Cl)ccc2OCc2ccc(F)cc2)o1.[Na+] |
| InChI | InChI=1S/C19H14ClFO4.Na/c20-14-3-7-17(24-11-12-1-4-15(21)5-2-12)13(9-14)10-16-6-8-18(25-16)19(22)23;/h1-9H,10-11H2,(H,22,23);/q;+1/p-1 |
| InChIKey | OERXUCZBVRDUIU-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |