C22H19ClFNO3 — CID 59384265
ethyl 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate (PubChem CID 59384265) has the molecular formula C22H19ClFNO3 and a molecular weight of 399.85 g/mol. Its IUPAC name is ethyl 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59384265 |
| Molecular Formula | C22H19ClFNO3 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(Cc2cc(Cl)ccc2OCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H19ClFNO3/c1-2-27-22(26)20-5-3-4-19(25-20)13-16-12-17(23)8-11-21(16)28-14-15-6-9-18(24)10-7-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | IQHKENJMXMMKOE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |