C20H15ClF3NO3S — CID 59786522
ethyl 2-[[5-chloro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 59786522) has the molecular formula C20H15ClF3NO3S and a molecular weight of 441.86 g/mol. Its IUPAC name is ethyl 2-[[5-chloro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[5-chloro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59786522 |
| Molecular Formula | C20H15ClF3NO3S |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | ethyl 2-[[5-chloro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Cc2cc(Cl)ccc2OCc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C20H15ClF3NO3S/c1-2-27-20(26)17-10-29-19(25-17)7-11-5-13(21)3-4-18(11)28-9-12-6-15(23)16(24)8-14(12)22/h3-6,8,10H,2,7,9H2,1H3 |
| InChIKey | KLRBXGJQYDCLEJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|