C24H26ClNO3 — CID 143249319
ethane;ethyl 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxylate (PubChem CID 143249319) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is ethane;ethyl 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxylate.
| Compound Name | ethane;ethyl 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143249319 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethane;ethyl 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cccc(Cc2cc(Cl)ccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C22H20ClNO3.C2H6/c1-2-26-22(25)20-10-6-9-19(24-20)14-17-13-18(23)11-12-21(17)27-15-16-7-4-3-5-8-16;1-2/h3-13H,2,14-15H2,1H3;1-2H3 |
| InChIKey | GAFDUQUPQBCYJW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |