C24H25ClN2O3 — CID 24753872
tert-butyl N-[6-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-pyridinyl]carbamate (PubChem CID 24753872) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is tert-butyl N-[6-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 24753872 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | tert-butyl N-[6-[(5-chloro-2-phenylmethoxyphenyl)methyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Cc2cc(Cl)ccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-24(2,3)30-23(28)27-22-11-7-10-20(26-22)15-18-14-19(25)12-13-21(18)29-16-17-8-5-4-6-9-17/h4-14H,15-16H2,1-3H3,(H,26,27,28) |
| InChIKey | NIDFJXLKDDKVLV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |