C20H16ClNO3 — CID 11646506
5-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-3-carboxylic acid (PubChem CID 11646506) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-3-carboxylic acid.
| Compound Name | 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11646506 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(Cc2cc(Cl)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H16ClNO3/c21-18-6-7-19(25-13-14-4-2-1-3-5-14)16(10-18)8-15-9-17(20(23)24)12-22-11-15/h1-7,9-12H,8,13H2,(H,23,24) |
| InChIKey | WKNRAANUUPNASJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |