C20H18Cl2N2O2 — CID 140535401
6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxamide;hydrochloride (PubChem CID 140535401) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxamide;hydrochloride.
| Compound Name | 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 140535401 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 6-[(5-chloro-2-phenylmethoxyphenyl)methyl]pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(Cc2cc(Cl)ccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C20H17ClN2O2.ClH/c21-16-9-10-19(25-13-14-5-2-1-3-6-14)15(11-16)12-17-7-4-8-18(23-17)20(22)24;/h1-11H,12-13H2,(H2,22,24);1H |
| InChIKey | MVRZJOZNIZMCAJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |