C24H20N2O3 — CID 71567698
4,8-bis(phenylmethoxy)quinoline-2-carboxamide (PubChem CID 71567698) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4,8-bis(phenylmethoxy)quinoline-2-carboxamide.
| Compound Name | 4,8-bis(phenylmethoxy)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71567698 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4,8-bis(phenylmethoxy)quinoline-2-carboxamide |
| SMILES | NC(=O)c1cc(OCc2ccccc2)c2cccc(OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C24H20N2O3/c25-24(27)20-14-22(29-16-18-10-5-2-6-11-18)19-12-7-13-21(23(19)26-20)28-15-17-8-3-1-4-9-17/h1-14H,15-16H2,(H2,25,27) |
| InChIKey | ZEJHUXFLOPKLQL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |