C21H17NO6 — CID 54512111
3,4-bis(phenylmethoxy)pyridine-2,6-dicarboxylic acid (PubChem CID 54512111) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3,4-bis(phenylmethoxy)pyridine-2,6-dicarboxylic acid.
| Compound Name | 3,4-bis(phenylmethoxy)pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 54512111 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3,4-bis(phenylmethoxy)pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(C(=O)O)n1 |
| InChI | InChI=1S/C21H17NO6/c23-20(24)16-11-17(27-12-14-7-3-1-4-8-14)19(18(22-16)21(25)26)28-13-15-9-5-2-6-10-15/h1-11H,12-13H2,(H,23,24)(H,25,26) |
| InChIKey | YJVXHTUQYWKRTA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |