C26H19ClN2O4 — CID 174188709
1-chloro-6,7-bis(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 174188709) has the molecular formula C26H19ClN2O4 and a molecular weight of 458.90 g/mol. Its IUPAC name is 1-chloro-6,7-bis(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-chloro-6,7-bis(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 174188709 |
| Molecular Formula | C26H19ClN2O4 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1-chloro-6,7-bis(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]c3cc(OCc4ccccc4)c(OCc4ccccc4)cc32)c(Cl)n1 |
| InChI | InChI=1S/C26H19ClN2O4/c27-25-24-19(11-21(29-25)26(30)31)18-12-22(32-14-16-7-3-1-4-8-16)23(13-20(18)28-24)33-15-17-9-5-2-6-10-17/h1-13,28H,14-15H2,(H,30,31) |
| InChIKey | MFFFWLAXYWKYOS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|