C19H12ClFN2O2 — CID 170776316
benzyl 1-chloro-6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 170776316) has the molecular formula C19H12ClFN2O2 and a molecular weight of 354.77 g/mol. Its IUPAC name is benzyl 1-chloro-6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | benzyl 1-chloro-6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 170776316 |
| Molecular Formula | C19H12ClFN2O2 |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | benzyl 1-chloro-6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc2c([nH]c3ccc(F)cc32)c(Cl)n1 |
| InChI | InChI=1S/C19H12ClFN2O2/c20-18-17-14(13-8-12(21)6-7-15(13)22-17)9-16(23-18)19(24)25-10-11-4-2-1-3-5-11/h1-9,22H,10H2 |
| InChIKey | NSEXGVBTAORSGJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|