C15H13FN2O2 — CID 10333417
propyl 6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 10333417) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is propyl 6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | propyl 6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10333417 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | propyl 6-fluoro-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCOC(=O)c1cc2c(cn1)[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C15H13FN2O2/c1-2-5-20-15(19)13-7-11-10-6-9(16)3-4-12(10)18-14(11)8-17-13/h3-4,6-8,18H,2,5H2,1H3 |
| InChIKey | ZLGLMSLIGAXDKW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |