C14H11N3O4 — CID 13037306
ethyl 7-nitro-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13037306) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is ethyl 7-nitro-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 7-nitro-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 13037306 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | ethyl 7-nitro-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)[nH]c1cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C14H11N3O4/c1-2-21-14(18)12-6-10-9-4-3-8(17(19)20)5-11(9)16-13(10)7-15-12/h3-7,16H,2H2,1H3 |
| InChIKey | CWXMBDOTRNLNHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|