C13H10N4O5 — CID 137098983
ethyl 7-nitro-5-oxo-4H-pyrazolo[1,5-a]quinazoline-2-carboxylate (PubChem CID 137098983) has the molecular formula C13H10N4O5 and a molecular weight of 302.25 g/mol. Its IUPAC name is ethyl 7-nitro-5-oxo-4H-pyrazolo[1,5-a]quinazoline-2-carboxylate.
| Compound Name | ethyl 7-nitro-5-oxo-4H-pyrazolo[1,5-a]quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 137098983 |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | ethyl 7-nitro-5-oxo-4H-pyrazolo[1,5-a]quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc2[nH]c(=O)c3cc([N+](=O)[O-])ccc3n2n1 |
| InChI | InChI=1S/C13H10N4O5/c1-2-22-13(19)9-6-11-14-12(18)8-5-7(17(20)21)3-4-10(8)16(11)15-9/h3-6H,2H2,1H3,(H,14,18) |
| InChIKey | BBMURXWMDVESIT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|