C15H14BrN5O6 — CID 70272047
ethyl 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrazole-3-carboxylate;hydrobromide (PubChem CID 70272047) has the molecular formula C15H14BrN5O6 and a molecular weight of 440.21 g/mol. Its IUPAC name is ethyl 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrazole-3-carboxylate;hydrobromide.
| Compound Name | ethyl 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrazole-3-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 70272047 |
| Molecular Formula | C15H14BrN5O6 |
| Molecular Weight | 440.21 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | ethyl 1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrazole-3-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1ccn(Cc2cc([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)n1 |
| InChI | InChI=1S/C15H13N5O6.BrH/c1-2-26-15(23)10-3-4-19(18-10)7-8-5-9(20(24)25)6-11-12(8)17-14(22)13(21)16-11;/h3-6H,2,7H2,1H3,(H,16,21)(H,17,22);1H |
| InChIKey | IIZYOIDLODUPBA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|