C13H12N4O8 — CID 18706657
2-[carboxymethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid (PubChem CID 18706657) has the molecular formula C13H12N4O8 and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[carboxymethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 18706657 |
| Molecular Formula | C13H12N4O8 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[carboxymethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C13H12N4O8/c18-9(19)4-16(5-10(20)21)3-6-1-7(17(24)25)2-8-11(6)15-13(23)12(22)14-8/h1-2H,3-5H2,(H,14,22)(H,15,23)(H,18,19)(H,20,21) |
| InChIKey | DZPVSJOSESRRSF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 186.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|