C17H15N5O6 — CID 174394769
methyl N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-N-phenylcarbamate (PubChem CID 174394769) has the molecular formula C17H15N5O6 and a molecular weight of 385.34 g/mol. Its IUPAC name is methyl N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-N-phenylcarbamate.
| Compound Name | methyl N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-N-phenylcarbamate |
|---|---|
| PubChem CID | 174394769 |
| Molecular Formula | C17H15N5O6 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | methyl N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-N-phenylcarbamate |
| SMILES | COC(=O)N(NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C17H15N5O6/c1-28-17(25)21(11-5-3-2-4-6-11)18-9-10-7-12(22(26)27)8-13-14(10)20-16(24)15(23)19-13/h2-8,18H,9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | UWWOHTNEMIEBON-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|