C17H18N4O7P+ — CID 23297967
5-[[benzyl(methyl)amino]methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium (PubChem CID 23297967) has the molecular formula C17H18N4O7P+ and a molecular weight of 421.33 g/mol. Its IUPAC name is 5-[[benzyl(methyl)amino]methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium.
| Compound Name | 5-[[benzyl(methyl)amino]methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 23297967 |
| Molecular Formula | C17H18N4O7P+ |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[[benzyl(methyl)amino]methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;dihydroxy(oxo)phosphanium |
| SMILES | CN(Cc1ccccc1)Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12.O=[P+](O)O |
| InChI | InChI=1S/C17H16N4O4.HO3P/c1-20(9-11-5-3-2-4-6-11)10-12-7-13(21(24)25)8-14-15(12)19-17(23)16(22)18-14;1-4(2)3/h2-8H,9-10H2,1H3,(H,18,22)(H,19,23);(H-,1,2,3)/p+1 |
| InChIKey | JNHLPTUKILEDPU-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|