C14H14N5O6+ — CID 18706303
5-[(1-methyl-2,6-dioxopiperazin-1-ium-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 18706303) has the molecular formula C14H14N5O6+ and a molecular weight of 348.30 g/mol. Its IUPAC name is 5-[(1-methyl-2,6-dioxopiperazin-1-ium-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 5-[(1-methyl-2,6-dioxopiperazin-1-ium-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 18706303 |
| Molecular Formula | C14H14N5O6+ |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-[(1-methyl-2,6-dioxopiperazin-1-ium-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | C[N+]1(Cc2cc([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)C(=O)CNCC1=O |
| InChI | InChI=1S/C14H13N5O6/c1-19(10(20)4-15-5-11(19)21)6-7-2-8(18(24)25)3-9-12(7)17-14(23)13(22)16-9/h2-3,15H,4-6H2,1H3,(H-,16,17,22,23)/p+1 |
| InChIKey | WYTHDPQAGWCSMK-UHFFFAOYSA-O |
| XLogP | -1.27 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|