C14H17N5O4 — CID 173306739
7-nitro-5-[(piperidin-1-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 173306739) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 7-nitro-5-[(piperidin-1-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-nitro-5-[(piperidin-1-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 173306739 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 7-nitro-5-[(piperidin-1-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc(CNN3CCCCC3)c2[nH]c1=O |
| InChI | InChI=1S/C14H17N5O4/c20-13-14(21)17-12-9(8-15-18-4-2-1-3-5-18)6-10(19(22)23)7-11(12)16-13/h6-7,15H,1-5,8H2,(H,16,20)(H,17,21) |
| InChIKey | LMUOHHNOHUDNOE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|