C16H20BrN5O5 — CID 18706664
2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxamide;hydrobromide (PubChem CID 18706664) has the molecular formula C16H20BrN5O5 and a molecular weight of 442.27 g/mol. Its IUPAC name is 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxamide;hydrobromide.
| Compound Name | 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 18706664 |
| Molecular Formula | C16H20BrN5O5 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxamide;hydrobromide |
| SMILES | Br.NC(=O)C1CCCCC1NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C16H19N5O5.BrH/c17-14(22)10-3-1-2-4-11(10)18-7-8-5-9(21(25)26)6-12-13(8)20-16(24)15(23)19-12;/h5-6,10-11,18H,1-4,7H2,(H2,17,22)(H,19,23)(H,20,24);1H |
| InChIKey | HCNWYMZQUIATSP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|