C15H15N7O5 — CID 54456058
(2S)-3-(1H-imidazol-5-yl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanamide (PubChem CID 54456058) has the molecular formula C15H15N7O5 and a molecular weight of 373.33 g/mol. Its IUPAC name is (2S)-3-(1H-imidazol-5-yl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanamide.
| Compound Name | (2S)-3-(1H-imidazol-5-yl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 54456058 |
| Molecular Formula | C15H15N7O5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2S)-3-(1H-imidazol-5-yl)-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanamide |
| SMILES | NC(=O)[C@H](Cc1cnc[nH]1)NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C15H15N7O5/c16-13(23)11(2-8-5-17-6-19-8)18-4-7-1-9(22(26)27)3-10-12(7)21-15(25)14(24)20-10/h1,3,5-6,11,18H,2,4H2,(H2,16,23)(H,17,19)(H,20,24)(H,21,25)/t11-/m0/s1 |
| InChIKey | WYGONSIOUDRUCT-NSHDSACASA-N |
| XLogP | -0.97 |
| TPSA | 192.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|