C13H15N4O9P — CID 18706348
4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phosphonobutanoic acid (PubChem CID 18706348) has the molecular formula C13H15N4O9P and a molecular weight of 402.26 g/mol. Its IUPAC name is 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phosphonobutanoic acid.
| Compound Name | 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phosphonobutanoic acid |
|---|---|
| PubChem CID | 18706348 |
| Molecular Formula | C13H15N4O9P |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-2-phosphonobutanoic acid |
| SMILES | O=C(O)C(CCNCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)P(=O)(O)O |
| InChI | InChI=1S/C13H15N4O9P/c18-11-12(19)16-10-6(3-7(17(22)23)4-8(10)15-11)5-14-2-1-9(13(20)21)27(24,25)26/h3-4,9,14H,1-2,5H2,(H,15,18)(H,16,19)(H,20,21)(H2,24,25,26) |
| InChIKey | KVWLBFCBESPEBG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 215.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|