C16H15N7O7 — CID 57102397
(2S)-2-amino-3-[1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylcarbamoyl]imidazol-4-yl]propanoic acid (PubChem CID 57102397) has the molecular formula C16H15N7O7 and a molecular weight of 417.34 g/mol. Its IUPAC name is (2S)-2-amino-3-[1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylcarbamoyl]imidazol-4-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylcarbamoyl]imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 57102397 |
| Molecular Formula | C16H15N7O7 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (2S)-2-amino-3-[1-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylcarbamoyl]imidazol-4-yl]propanoic acid |
| SMILES | N[C@@H](Cc1cn(C(=O)NCc2cc([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)cn1)C(=O)O |
| InChI | InChI=1S/C16H15N7O7/c17-10(15(26)27)2-8-5-22(6-19-8)16(28)18-4-7-1-9(23(29)30)3-11-12(7)21-14(25)13(24)20-11/h1,3,5-6,10H,2,4,17H2,(H,18,28)(H,20,24)(H,21,25)(H,26,27)/t10-/m0/s1 |
| InChIKey | ATUSWWNJBWXZHJ-JTQLQIEISA-N |
| XLogP | -0.97 |
| TPSA | 219.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|