C18H17BrN4O6 — CID 70271843
3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-phenylpropanoic acid;hydrobromide (PubChem CID 70271843) has the molecular formula C18H17BrN4O6 and a molecular weight of 465.26 g/mol. Its IUPAC name is 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-phenylpropanoic acid;hydrobromide.
| Compound Name | 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-phenylpropanoic acid;hydrobromide |
|---|---|
| PubChem CID | 70271843 |
| Molecular Formula | C18H17BrN4O6 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-3-phenylpropanoic acid;hydrobromide |
| SMILES | Br.O=C(O)CC(NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C18H16N4O6.BrH/c23-15(24)8-13(10-4-2-1-3-5-10)19-9-11-6-12(22(27)28)7-14-16(11)21-18(26)17(25)20-14;/h1-7,13,19H,8-9H2,(H,20,25)(H,21,26)(H,23,24);1H |
| InChIKey | ULASRNHSRWOVRI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|