C15H15Br2N5O4 — CID 18706669
7-nitro-5-[(pyridin-4-ylmethylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;dihydrobromide (PubChem CID 18706669) has the molecular formula C15H15Br2N5O4 and a molecular weight of 489.12 g/mol. Its IUPAC name is 7-nitro-5-[(pyridin-4-ylmethylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;dihydrobromide.
| Compound Name | 7-nitro-5-[(pyridin-4-ylmethylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;dihydrobromide |
|---|---|
| PubChem CID | 18706669 |
| Molecular Formula | C15H15Br2N5O4 |
| Molecular Weight | 489.12 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | 7-nitro-5-[(pyridin-4-ylmethylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;dihydrobromide |
| SMILES | Br.Br.O=c1[nH]c2cc([N+](=O)[O-])cc(CNCc3ccncc3)c2[nH]c1=O |
| InChI | InChI=1S/C15H13N5O4.2BrH/c21-14-15(22)19-13-10(5-11(20(23)24)6-12(13)18-14)8-17-7-9-1-3-16-4-2-9;;/h1-6,17H,7-8H2,(H,18,21)(H,19,22);2*1H |
| InChIKey | UGJJLURPYCOMIJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|