C14H16N4O5 — CID 54202406
N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pentanamide (PubChem CID 54202406) has the molecular formula C14H16N4O5 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pentanamide.
| Compound Name | N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 54202406 |
| Molecular Formula | C14H16N4O5 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C14H16N4O5/c1-2-3-4-11(19)15-7-8-5-9(18(22)23)6-10-12(8)17-14(21)13(20)16-10/h5-6H,2-4,7H2,1H3,(H,15,19)(H,16,20)(H,17,21) |
| InChIKey | PQEFODIJOVQWSA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|