C12H13N5O7 — CID 174434793
2-amino-3-hydroxy-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid (PubChem CID 174434793) has the molecular formula C12H13N5O7 and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-amino-3-hydroxy-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid.
| Compound Name | 2-amino-3-hydroxy-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 174434793 |
| Molecular Formula | C12H13N5O7 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-amino-3-hydroxy-2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid |
| SMILES | NC(CO)(NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)C(=O)O |
| InChI | InChI=1S/C12H13N5O7/c13-12(4-18,11(21)22)14-3-5-1-6(17(23)24)2-7-8(5)16-10(20)9(19)15-7/h1-2,14,18H,3-4,13H2,(H,15,19)(H,16,20)(H,21,22) |
| InChIKey | FLQFMQFDAKMUPT-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 204.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|