C16H18N4O6 — CID 18706490
3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 18706490) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18706490 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(NCc2cc([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C16H18N4O6/c21-14-15(22)19-13-9(5-11(20(25)26)6-12(13)18-14)7-17-10-3-1-2-8(4-10)16(23)24/h5-6,8,10,17H,1-4,7H2,(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | VWRKNNHQNMGINW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|