C11H10N4O6 — CID 18706345
2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]acetic acid (PubChem CID 18706345) has the molecular formula C11H10N4O6 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]acetic acid.
| Compound Name | 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 18706345 |
| Molecular Formula | C11H10N4O6 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C11H10N4O6/c16-8(17)4-12-3-5-1-6(15(20)21)2-7-9(5)14-11(19)10(18)13-7/h1-2,12H,3-4H2,(H,13,18)(H,14,19)(H,16,17) |
| InChIKey | VEIVZAGDCKFHLT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|