C14H14N4O7 — CID 57119351
5-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-5-oxopentanoic acid (PubChem CID 57119351) has the molecular formula C14H14N4O7 and a molecular weight of 350.29 g/mol. Its IUPAC name is 5-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 57119351 |
| Molecular Formula | C14H14N4O7 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 5-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C14H14N4O7/c19-10(2-1-3-11(20)21)15-6-7-4-8(18(24)25)5-9-12(7)17-14(23)13(22)16-9/h4-5H,1-3,6H2,(H,15,19)(H,16,22)(H,17,23)(H,20,21) |
| InChIKey | ZIRXWZKVJDRVLX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 175.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|