C20H20N4O4 — CID 18706640
7-nitro-5-[(1-phenylpent-4-en-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 18706640) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 7-nitro-5-[(1-phenylpent-4-en-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-nitro-5-[(1-phenylpent-4-en-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 18706640 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 7-nitro-5-[(1-phenylpent-4-en-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | C=CCC(Cc1ccccc1)NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C20H20N4O4/c1-2-6-15(9-13-7-4-3-5-8-13)21-12-14-10-16(24(27)28)11-17-18(14)23-20(26)19(25)22-17/h2-5,7-8,10-11,15,21H,1,6,9,12H2,(H,22,25)(H,23,26) |
| InChIKey | GMXMOBANNZWEDJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|