C12H8N6O6 — CID 18706626
4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-1,2,4-triazole-3-carboxylic acid (PubChem CID 18706626) has the molecular formula C12H8N6O6 and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 18706626 |
| Molecular Formula | C12H8N6O6 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1nncn1Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C12H8N6O6/c19-10-11(20)15-8-5(1-6(18(23)24)2-7(8)14-10)3-17-4-13-16-9(17)12(21)22/h1-2,4H,3H2,(H,14,19)(H,15,20)(H,21,22) |
| InChIKey | ZKTWVFRVYSBBJE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 176.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|